C13H22O4 — CID 134948075
(3aS,4R,6aR)-4-[3-(1,3-dioxan-2-yl)propyl]-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan (PubChem CID 134948075) has the molecular formula C13H22O4 and a molecular weight of 242.31 g/mol. Its IUPAC name is (3aS,4R,6aR)-4-[3-(1,3-dioxan-2-yl)propyl]-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan.
| Compound Name | (3aS,4R,6aR)-4-[3-(1,3-dioxan-2-yl)propyl]-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan |
|---|---|
| PubChem CID | 134948075 |
| Molecular Formula | C13H22O4 |
| Molecular Weight | 242.31 g/mol |
| Exact Mass | 242.15 |
| IUPAC Name | (3aS,4R,6aR)-4-[3-(1,3-dioxan-2-yl)propyl]-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan |
| SMILES | C1COC(CCC[C@H]2CO[C@H]3OCC[C@@H]23)OC1 |
| InChI | InChI=1S/C13H22O4/c1(4-12-14-6-2-7-15-12)3-10-9-17-13-11(10)5-8-16-13/h10-13H,1-9H2/t10-,11-,13+/m0/s1 |
| InChIKey | CDZSVJUNTHISMU-GMXVVIOVSA-N |
| XLogP | 1.93 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.31 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |