C14H15F3O5S — CID 134948143
[(3Z)-5-[(4-methoxyphenyl)methoxy]penta-1,3-dien-3-yl] trifluoromethanesulfonate (PubChem CID 134948143) has the molecular formula C14H15F3O5S and a molecular weight of 352.33 g/mol. Its IUPAC name is [(3Z)-5-[(4-methoxyphenyl)methoxy]penta-1,3-dien-3-yl] trifluoromethanesulfonate.
| Compound Name | [(3Z)-5-[(4-methoxyphenyl)methoxy]penta-1,3-dien-3-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 134948143 |
| Molecular Formula | C14H15F3O5S |
| Molecular Weight | 352.33 g/mol |
| Exact Mass | 352.06 |
| IUPAC Name | [(3Z)-5-[(4-methoxyphenyl)methoxy]penta-1,3-dien-3-yl] trifluoromethanesulfonate |
| SMILES | C=C/C(=C/COCc1ccc(OC)cc1)OS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C14H15F3O5S/c1-3-12(22-23(18,19)14(15,16)17)8-9-21-10-11-4-6-13(20-2)7-5-11/h3-8H,1,9-10H2,2H3/b12-8- |
| InChIKey | VZLREQRFVVICES-WQLSENKSSA-N |
| XLogP | 3.15 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.33 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|