About (E)-4,4-difluoro-1-phenyldec-1-en-3-ol
(E)-4,4-difluoro-1-phenyldec-1-en-3-ol (PubChem CID 134948280) has the molecular formula C16H22F2O
and a molecular weight of 268.35 g/mol. Its IUPAC name is (E)-4,4-difluoro-1-phenyldec-1-en-3-ol.
Molecular Properties
| Compound Name | (E)-4,4-difluoro-1-phenyldec-1-en-3-ol |
| PubChem CID | 134948280 |
| Molecular Formula | C16H22F2O |
| Molecular Weight | 268.35 g/mol |
| Exact Mass | 268.16 |
| IUPAC Name | (E)-4,4-difluoro-1-phenyldec-1-en-3-ol |
| SMILES | CCCCCCC(F)(F)C(O)/C=C/c1ccccc1 |
| InChI | InChI=1S/C16H22F2O/c1-2-3-4-8-13-16(17,18)15(19)12-11-14-9-6-5-7-10-14/h5-7,9-12,15,19H,2-4,8,13H2,1H3/b12-11+ |
| InChIKey | HVWINTSAEMDIEM-VAWYXSNFSA-N |
| XLogP | 4.67 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.35 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (E)-4,4-difluoro-1-phenyldec-1-en-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-4,4-difluoro-1-phenyldec-1-en-3-ol?
The IUPAC name of (E)-4,4-difluoro-1-phenyldec-1-en-3-ol (CID 134948280) is (E)-4,4-difluoro-1-phenyldec-1-en-3-ol.
What is the SMILES notation for (E)-4,4-difluoro-1-phenyldec-1-en-3-ol?
The canonical SMILES for (E)-4,4-difluoro-1-phenyldec-1-en-3-ol is CCCCCCC(F)(F)C(O)/C=C/c1ccccc1.
What is the InChIKey of (E)-4,4-difluoro-1-phenyldec-1-en-3-ol?
The InChIKey is HVWINTSAEMDIEM-VAWYXSNFSA-N. The full InChI is InChI=1S/C16H22F2O/c1-2-3-4-8-13-16(17,18)15(19)12-11-14-9-6-5-7-10-14/h5-7,9-12,15,19H,2-4,8,13H2,1H3/b12-11+.
What are the key properties of (E)-4,4-difluoro-1-phenyldec-1-en-3-ol?
(E)-4,4-difluoro-1-phenyldec-1-en-3-ol has a molecular weight of 268.35 g/mol, XLogP of 4.67, 8 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-4,4-difluoro-1-phenyldec-1-en-3-ol is sourced from PubChem (CID 134948280), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).