C22H25NO5 — CID 134948297
5,6,15,16-tetramethoxy-1-azatetracyclo[9.8.0.03,8.012,17]nonadeca-3,5,7,12(17),13,15-hexaen-2-one (PubChem CID 134948297) has the molecular formula C22H25NO5 and a molecular weight of 383.44 g/mol. Its IUPAC name is 5,6,15,16-tetramethoxy-1-azatetracyclo[9.8.0.03,8.012,17]nonadeca-3,5,7,12(17),13,15-hexaen-2-one.
| Compound Name | 5,6,15,16-tetramethoxy-1-azatetracyclo[9.8.0.03,8.012,17]nonadeca-3,5,7,12(17),13,15-hexaen-2-one |
|---|---|
| PubChem CID | 134948297 |
| Molecular Formula | C22H25NO5 |
| Molecular Weight | 383.44 g/mol |
| Exact Mass | 383.17 |
| IUPAC Name | 5,6,15,16-tetramethoxy-1-azatetracyclo[9.8.0.03,8.012,17]nonadeca-3,5,7,12(17),13,15-hexaen-2-one |
| SMILES | COc1cc2c(cc1OC)C(=O)N1CCc3c(ccc(OC)c3OC)C1CC2 |
| InChI | InChI=1S/C22H25NO5/c1-25-18-8-6-14-15(21(18)28-4)9-10-23-17(14)7-5-13-11-19(26-2)20(27-3)12-16(13)22(23)24/h6,8,11-12,17H,5,7,9-10H2,1-4H3 |
| InChIKey | WXXWEMSYIIXRFY-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.44 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |