C29H44O7Si — CID 134948327
[(1S,4S,5S,9R,10R,11R,12R,13R,15R,17R)-11-[tert-butyl(dimethyl)silyl]oxy-3,10,14,14,17-pentamethyl-7,18-dioxo-6,8-dioxapentacyclo[10.5.1.01,5.05,9.013,15]octadec-2-en-4-yl] acetate (PubChem CID 134948327) has the molecular formula C29H44O7Si and a molecular weight of 532.75 g/mol. Its IUPAC name is [(1S,4S,5S,9R,10R,11R,12R,13R,15R,17R)-11-[tert-butyl(dimethyl)silyl]oxy-3,10,14,14,17-pentamethyl-7,18-dioxo-6,8-dioxapentacyclo[10.5.1.01,5.05,9.013,15]octadec-2-en-4-yl] acetate.
| Compound Name | [(1S,4S,5S,9R,10R,11R,12R,13R,15R,17R)-11-[tert-butyl(dimethyl)silyl]oxy-3,10,14,14,17-pentamethyl-7,18-dioxo-6,8-dioxapentacyclo[10.5.1.01,5.05,9.013,15]octadec-2-en-4-yl] acetate |
|---|---|
| PubChem CID | 134948327 |
| Molecular Formula | C29H44O7Si |
| Molecular Weight | 532.75 g/mol |
| Exact Mass | 532.29 |
| IUPAC Name | [(1S,4S,5S,9R,10R,11R,12R,13R,15R,17R)-11-[tert-butyl(dimethyl)silyl]oxy-3,10,14,14,17-pentamethyl-7,18-dioxo-6,8-dioxapentacyclo[10.5.1.01,5.05,9.013,15]octadec-2-en-4-yl] acetate |
| SMILES | CC(=O)O[C@H]1C(C)=C[C@]23C(=O)[C@@H]([C@H](O[Si](C)(C)C(C)(C)C)[C@H](C)[C@H]4OC(=O)O[C@@]412)[C@H]1[C@@H](C[C@H]3C)C1(C)C |
| InChI | InChI=1S/C29H44O7Si/c1-14-13-28-15(2)12-18-20(27(18,8)9)19(22(28)31)21(36-37(10,11)26(5,6)7)16(3)24-29(28,35-25(32)34-24)23(14)33-17(4)30/h13,15-16,18-21,23-24H,12H2,1-11H3/t15-,16+,18-,19-,20-,21-,23+,24-,28+,29-/m1/s1 |
| InChIKey | VXEREERZSOGYHJ-YXHGTYRYSA-N |
| XLogP | 5.68 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.75 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|