C39H61N2OP — CID 134948333
1-[(4S,5S)-4,5-dicyclohexyl-2-(2-dicyclohexylphosphanylphenyl)-4,5-dihydroimidazol-1-yl]-2-ethylbutan-1-one (PubChem CID 134948333) has the molecular formula C39H61N2OP and a molecular weight of 604.90 g/mol. Its IUPAC name is 1-[(4S,5S)-4,5-dicyclohexyl-2-(2-dicyclohexylphosphanylphenyl)-4,5-dihydroimidazol-1-yl]-2-ethylbutan-1-one.
| Compound Name | 1-[(4S,5S)-4,5-dicyclohexyl-2-(2-dicyclohexylphosphanylphenyl)-4,5-dihydroimidazol-1-yl]-2-ethylbutan-1-one |
|---|---|
| PubChem CID | 134948333 |
| Molecular Formula | C39H61N2OP |
| Molecular Weight | 604.90 g/mol |
| Exact Mass | 604.45 |
| IUPAC Name | 1-[(4S,5S)-4,5-dicyclohexyl-2-(2-dicyclohexylphosphanylphenyl)-4,5-dihydroimidazol-1-yl]-2-ethylbutan-1-one |
| SMILES | CCC(CC)C(=O)N1C(c2ccccc2P(C2CCCCC2)C2CCCCC2)=N[C@@H](C2CCCCC2)[C@@H]1C1CCCCC1 |
| InChI | InChI=1S/C39H61N2OP/c1-3-29(4-2)39(42)41-37(31-21-11-6-12-22-31)36(30-19-9-5-10-20-30)40-38(41)34-27-17-18-28-35(34)43(32-23-13-7-14-24-32)33-25-15-8-16-26-33/h17-18,27-33,36-37H,3-16,19-26H2,1-2H3/t36-,37-/m0/s1 |
| InChIKey | YVXFMTNRZFWQSU-BCRBLDSWSA-N |
| XLogP | 10.38 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.90 |
| LogP ≤ 5 | 10.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|