C26H43BrO3Si — CID 134948530
(2'R,4R,4aS,8aR)-8a-(2-bromoprop-2-enyl)-2'-[[tert-butyl(dimethyl)silyl]oxymethyl]-3',3'-dimethylspiro[3,4a,5,8-tetrahydroisochromene-4,1'-cyclohexane]-1-one (PubChem CID 134948530) has the molecular formula C26H43BrO3Si and a molecular weight of 511.62 g/mol. Its IUPAC name is (2'R,4R,4aS,8aR)-8a-(2-bromoprop-2-enyl)-2'-[[tert-butyl(dimethyl)silyl]oxymethyl]-3',3'-dimethylspiro[3,4a,5,8-tetrahydroisochromene-4,1'-cyclohexane]-1-one.
| Compound Name | (2'R,4R,4aS,8aR)-8a-(2-bromoprop-2-enyl)-2'-[[tert-butyl(dimethyl)silyl]oxymethyl]-3',3'-dimethylspiro[3,4a,5,8-tetrahydroisochromene-4,1'-cyclohexane]-1-one |
|---|---|
| PubChem CID | 134948530 |
| Molecular Formula | C26H43BrO3Si |
| Molecular Weight | 511.62 g/mol |
| Exact Mass | 510.22 |
| IUPAC Name | (2'R,4R,4aS,8aR)-8a-(2-bromoprop-2-enyl)-2'-[[tert-butyl(dimethyl)silyl]oxymethyl]-3',3'-dimethylspiro[3,4a,5,8-tetrahydroisochromene-4,1'-cyclohexane]-1-one |
| SMILES | C=C(Br)C[C@]12CC=CC[C@H]1[C@@]1(CCCC(C)(C)[C@H]1CO[Si](C)(C)C(C)(C)C)COC2=O |
| InChI | InChI=1S/C26H43BrO3Si/c1-19(27)16-25-14-10-9-12-20(25)26(18-29-22(25)28)15-11-13-24(5,6)21(26)17-30-31(7,8)23(2,3)4/h9-10,20-21H,1,11-18H2,2-8H3/t20-,21-,25-,26-/m1/s1 |
| InChIKey | BYDLRMLYHGCQQQ-FJIJVGMHSA-N |
| XLogP | 7.63 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.62 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|