C23H36O4Si — CID 134948531
[(1R,6R)-2,2-dimethyl-6-(prop-2-enoyloxymethyl)-6-[(1E,3E)-4-trimethylsilylbuta-1,3-dienyl]cyclohexyl]methyl prop-2-enoate (PubChem CID 134948531) has the molecular formula C23H36O4Si and a molecular weight of 404.62 g/mol. Its IUPAC name is [(1R,6R)-2,2-dimethyl-6-(prop-2-enoyloxymethyl)-6-[(1E,3E)-4-trimethylsilylbuta-1,3-dienyl]cyclohexyl]methyl prop-2-enoate.
| Compound Name | [(1R,6R)-2,2-dimethyl-6-(prop-2-enoyloxymethyl)-6-[(1E,3E)-4-trimethylsilylbuta-1,3-dienyl]cyclohexyl]methyl prop-2-enoate |
|---|---|
| PubChem CID | 134948531 |
| Molecular Formula | C23H36O4Si |
| Molecular Weight | 404.62 g/mol |
| Exact Mass | 404.24 |
| IUPAC Name | [(1R,6R)-2,2-dimethyl-6-(prop-2-enoyloxymethyl)-6-[(1E,3E)-4-trimethylsilylbuta-1,3-dienyl]cyclohexyl]methyl prop-2-enoate |
| SMILES | C=CC(=O)OC[C@@H]1C(C)(C)CCC[C@]1(/C=C/C=C/[Si](C)(C)C)COC(=O)C=C |
| InChI | InChI=1S/C23H36O4Si/c1-8-20(24)26-17-19-22(3,4)13-12-15-23(19,18-27-21(25)9-2)14-10-11-16-28(5,6)7/h8-11,14,16,19H,1-2,12-13,15,17-18H2,3-7H3/b14-10+,16-11+/t19-,23-/m1/s1 |
| InChIKey | WUIBVSHFHJALBV-KSBLIMLVSA-N |
| XLogP | 5.25 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.62 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|