C18H16F2O2S — CID 134948575
[4-(1,1-difluoro-1-phenylsulfanylbut-3-en-2-yl)phenyl] acetate (PubChem CID 134948575) has the molecular formula C18H16F2O2S and a molecular weight of 334.39 g/mol. Its IUPAC name is [4-(1,1-difluoro-1-phenylsulfanylbut-3-en-2-yl)phenyl] acetate.
| Compound Name | [4-(1,1-difluoro-1-phenylsulfanylbut-3-en-2-yl)phenyl] acetate |
|---|---|
| PubChem CID | 134948575 |
| Molecular Formula | C18H16F2O2S |
| Molecular Weight | 334.39 g/mol |
| Exact Mass | 334.08 |
| IUPAC Name | [4-(1,1-difluoro-1-phenylsulfanylbut-3-en-2-yl)phenyl] acetate |
| SMILES | C=CC(c1ccc(OC(C)=O)cc1)C(F)(F)Sc1ccccc1 |
| InChI | InChI=1S/C18H16F2O2S/c1-3-17(14-9-11-15(12-10-14)22-13(2)21)18(19,20)23-16-7-5-4-6-8-16/h3-12,17H,1H2,2H3 |
| InChIKey | LEWCUJFCUGHWDZ-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.39 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|