C26H28N2O2 — CID 134948853
(2S)-N-[(1R)-2-hydroxy-1,2,2-triphenylethyl]-4-methylpyrrolidine-2-carboxamide (PubChem CID 134948853) has the molecular formula C26H28N2O2 and a molecular weight of 400.52 g/mol. Its IUPAC name is (2S)-N-[(1R)-2-hydroxy-1,2,2-triphenylethyl]-4-methylpyrrolidine-2-carboxamide.
| Compound Name | (2S)-N-[(1R)-2-hydroxy-1,2,2-triphenylethyl]-4-methylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 134948853 |
| Molecular Formula | C26H28N2O2 |
| Molecular Weight | 400.52 g/mol |
| Exact Mass | 400.22 |
| IUPAC Name | (2S)-N-[(1R)-2-hydroxy-1,2,2-triphenylethyl]-4-methylpyrrolidine-2-carboxamide |
| SMILES | CC1CN[C@H](C(=O)N[C@H](c2ccccc2)C(O)(c2ccccc2)c2ccccc2)C1 |
| InChI | InChI=1S/C26H28N2O2/c1-19-17-23(27-18-19)25(29)28-24(20-11-5-2-6-12-20)26(30,21-13-7-3-8-14-21)22-15-9-4-10-16-22/h2-16,19,23-24,27,30H,17-18H2,1H3,(H,28,29)/t19?,23-,24+/m0/s1 |
| InChIKey | RHIGQBIKQTWMOK-ZJWHSJSFSA-N |
| XLogP | 3.78 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.52 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |