C39H46N2O6 — CID 134948877
(2R,3S,4R,5R)-5-hydroxy-1-(4-methylpiperazin-1-yl)-2,3,4,6-tetrakis(phenylmethoxy)hexan-1-one (PubChem CID 134948877) has the molecular formula C39H46N2O6 and a molecular weight of 638.81 g/mol. Its IUPAC name is (2R,3S,4R,5R)-5-hydroxy-1-(4-methylpiperazin-1-yl)-2,3,4,6-tetrakis(phenylmethoxy)hexan-1-one.
| Compound Name | (2R,3S,4R,5R)-5-hydroxy-1-(4-methylpiperazin-1-yl)-2,3,4,6-tetrakis(phenylmethoxy)hexan-1-one |
|---|---|
| PubChem CID | 134948877 |
| Molecular Formula | C39H46N2O6 |
| Molecular Weight | 638.81 g/mol |
| Exact Mass | 638.34 |
| IUPAC Name | (2R,3S,4R,5R)-5-hydroxy-1-(4-methylpiperazin-1-yl)-2,3,4,6-tetrakis(phenylmethoxy)hexan-1-one |
| SMILES | CN1CCN(C(=O)[C@H](OCc2ccccc2)[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H](O)COCc2ccccc2)CC1 |
| InChI | InChI=1S/C39H46N2O6/c1-40-22-24-41(25-23-40)39(43)38(47-29-34-20-12-5-13-21-34)37(46-28-33-18-10-4-11-19-33)36(45-27-32-16-8-3-9-17-32)35(42)30-44-26-31-14-6-2-7-15-31/h2-21,35-38,42H,22-30H2,1H3/t35-,36-,37+,38-/m1/s1 |
| InChIKey | BEPSTJRVNVAQSO-UXWDSZNOSA-N |
| XLogP | 5.09 |
| TPSA | 80.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.81 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |