C18H26O4 — CID 134949228
(2E,4E)-6-[(2S,4S,5R,6R)-4-hydroxy-5-methyl-6-[(1Z)-2-methylpenta-1,4-dienyl]oxan-2-yl]hexa-2,4-dienoic acid (PubChem CID 134949228) has the molecular formula C18H26O4 and a molecular weight of 306.40 g/mol. Its IUPAC name is (2E,4E)-6-[(2S,4S,5R,6R)-4-hydroxy-5-methyl-6-[(1Z)-2-methylpenta-1,4-dienyl]oxan-2-yl]hexa-2,4-dienoic acid.
| Compound Name | (2E,4E)-6-[(2S,4S,5R,6R)-4-hydroxy-5-methyl-6-[(1Z)-2-methylpenta-1,4-dienyl]oxan-2-yl]hexa-2,4-dienoic acid |
|---|---|
| PubChem CID | 134949228 |
| Molecular Formula | C18H26O4 |
| Molecular Weight | 306.40 g/mol |
| Exact Mass | 306.18 |
| IUPAC Name | (2E,4E)-6-[(2S,4S,5R,6R)-4-hydroxy-5-methyl-6-[(1Z)-2-methylpenta-1,4-dienyl]oxan-2-yl]hexa-2,4-dienoic acid |
| SMILES | C=CC/C(C)=C\[C@H]1O[C@@H](C/C=C/C=C/C(=O)O)C[C@H](O)[C@H]1C |
| InChI | InChI=1S/C18H26O4/c1-4-8-13(2)11-17-14(3)16(19)12-15(22-17)9-6-5-7-10-18(20)21/h4-7,10-11,14-17,19H,1,8-9,12H2,2-3H3,(H,20,21)/b6-5+,10-7+,13-11-/t14-,15+,16+,17-/m1/s1 |
| InChIKey | AFKHSOBLONLAAU-DLZQGQQVSA-N |
| XLogP | 3.25 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.40 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|