C27H39NO5Si — CID 134949258
ditert-butyl (5R)-5-[methyl(phenyl)carbamoyl]-3-trimethylsilylcyclohexa-1,3-diene-1,2-dicarboxylate (PubChem CID 134949258) has the molecular formula C27H39NO5Si and a molecular weight of 485.70 g/mol. Its IUPAC name is ditert-butyl (5R)-5-[methyl(phenyl)carbamoyl]-3-trimethylsilylcyclohexa-1,3-diene-1,2-dicarboxylate.
| Compound Name | ditert-butyl (5R)-5-[methyl(phenyl)carbamoyl]-3-trimethylsilylcyclohexa-1,3-diene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 134949258 |
| Molecular Formula | C27H39NO5Si |
| Molecular Weight | 485.70 g/mol |
| Exact Mass | 485.26 |
| IUPAC Name | ditert-butyl (5R)-5-[methyl(phenyl)carbamoyl]-3-trimethylsilylcyclohexa-1,3-diene-1,2-dicarboxylate |
| SMILES | CN(C(=O)[C@H]1C=C([Si](C)(C)C)C(C(=O)OC(C)(C)C)=C(C(=O)OC(C)(C)C)C1)c1ccccc1 |
| InChI | InChI=1S/C27H39NO5Si/c1-26(2,3)32-24(30)20-16-18(23(29)28(7)19-14-12-11-13-15-19)17-21(34(8,9)10)22(20)25(31)33-27(4,5)6/h11-15,17-18H,16H2,1-10H3/t18-/m1/s1 |
| InChIKey | UVOYBNVAGRYLME-GOSISDBHSA-N |
| XLogP | 5.45 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.70 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|