C21H32O3Si — CID 134949280
(1R,2S,6R,7S,12S,13S)-2,5,5,13-tetramethyl-12-prop-2-enyl-4-oxa-5-silatetracyclo[10.3.1.01,6.07,13]hexadecane-11,16-dione (PubChem CID 134949280) has the molecular formula C21H32O3Si and a molecular weight of 360.57 g/mol. Its IUPAC name is (1R,2S,6R,7S,12S,13S)-2,5,5,13-tetramethyl-12-prop-2-enyl-4-oxa-5-silatetracyclo[10.3.1.01,6.07,13]hexadecane-11,16-dione.
| Compound Name | (1R,2S,6R,7S,12S,13S)-2,5,5,13-tetramethyl-12-prop-2-enyl-4-oxa-5-silatetracyclo[10.3.1.01,6.07,13]hexadecane-11,16-dione |
|---|---|
| PubChem CID | 134949280 |
| Molecular Formula | C21H32O3Si |
| Molecular Weight | 360.57 g/mol |
| Exact Mass | 360.21 |
| IUPAC Name | (1R,2S,6R,7S,12S,13S)-2,5,5,13-tetramethyl-12-prop-2-enyl-4-oxa-5-silatetracyclo[10.3.1.01,6.07,13]hexadecane-11,16-dione |
| SMILES | C=CC[C@@]12C(=O)CCC[C@@H]3[C@@H]4[C@@](CC[C@@]31C)(C2=O)[C@H](C)CO[Si]4(C)C |
| InChI | InChI=1S/C21H32O3Si/c1-6-10-21-16(22)9-7-8-15-17-20(18(21)23,12-11-19(15,21)3)14(2)13-24-25(17,4)5/h6,14-15,17H,1,7-13H2,2-5H3/t14-,15-,17-,19+,20+,21+/m1/s1 |
| InChIKey | RHIWFZGUCVURFQ-GLSDQQHTSA-N |
| XLogP | 4.53 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.57 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|