C27H48O4Si2 — CID 134949283
(1R,2S,6R,7S,8S,9S)-9-acetyl-7-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-2,5,5,8-tetramethyl-9-prop-2-enyl-4-oxa-5-silatricyclo[6.2.2.01,6]dodecan-10-one (PubChem CID 134949283) has the molecular formula C27H48O4Si2 and a molecular weight of 492.85 g/mol. Its IUPAC name is (1R,2S,6R,7S,8S,9S)-9-acetyl-7-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-2,5,5,8-tetramethyl-9-prop-2-enyl-4-oxa-5-silatricyclo[6.2.2.01,6]dodecan-10-one.
| Compound Name | (1R,2S,6R,7S,8S,9S)-9-acetyl-7-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-2,5,5,8-tetramethyl-9-prop-2-enyl-4-oxa-5-silatricyclo[6.2.2.01,6]dodecan-10-one |
|---|---|
| PubChem CID | 134949283 |
| Molecular Formula | C27H48O4Si2 |
| Molecular Weight | 492.85 g/mol |
| Exact Mass | 492.31 |
| IUPAC Name | (1R,2S,6R,7S,8S,9S)-9-acetyl-7-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-2,5,5,8-tetramethyl-9-prop-2-enyl-4-oxa-5-silatricyclo[6.2.2.01,6]dodecan-10-one |
| SMILES | C=CC[C@]1(C(C)=O)C(=O)[C@]23CC[C@@]1(C)[C@H](CCO[Si](C)(C)C(C)(C)C)[C@H]2[Si](C)(C)OC[C@H]3C |
| InChI | InChI=1S/C27H48O4Si2/c1-12-14-27(20(3)28)23(29)26-16-15-25(27,7)21(13-17-30-33(10,11)24(4,5)6)22(26)32(8,9)31-18-19(26)2/h12,19,21-22H,1,13-18H2,2-11H3/t19-,21-,22-,25+,26+,27+/m1/s1 |
| InChIKey | JDCSCXTVUDMLOM-UEXPRZRLSA-N |
| XLogP | 6.78 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.85 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|