C18H29O6+ — CID 134949415
[(2R,4aS,5R,8S)-8-[(2R)-1-ethoxycarbonyloxy-1-oxopropan-2-yl]-2,5-dimethyl-4,4a,5,6,7,8-hexahydro-3H-naphthalen-2-yl]oxyoxidanium (PubChem CID 134949415) has the molecular formula C18H29O6+ and a molecular weight of 341.42 g/mol. Its IUPAC name is [(2R,4aS,5R,8S)-8-[(2R)-1-ethoxycarbonyloxy-1-oxopropan-2-yl]-2,5-dimethyl-4,4a,5,6,7,8-hexahydro-3H-naphthalen-2-yl]oxyoxidanium.
| Compound Name | [(2R,4aS,5R,8S)-8-[(2R)-1-ethoxycarbonyloxy-1-oxopropan-2-yl]-2,5-dimethyl-4,4a,5,6,7,8-hexahydro-3H-naphthalen-2-yl]oxyoxidanium |
|---|---|
| PubChem CID | 134949415 |
| Molecular Formula | C18H29O6+ |
| Molecular Weight | 341.42 g/mol |
| Exact Mass | 341.20 |
| IUPAC Name | [(2R,4aS,5R,8S)-8-[(2R)-1-ethoxycarbonyloxy-1-oxopropan-2-yl]-2,5-dimethyl-4,4a,5,6,7,8-hexahydro-3H-naphthalen-2-yl]oxyoxidanium |
| SMILES | CCOC(=O)OC(=O)[C@H](C)[C@@H]1CC[C@@H](C)[C@@H]2CC[C@@](C)(O[OH2+])C=C21 |
| InChI | InChI=1S/C18H28O6/c1-5-22-17(20)23-16(19)12(3)14-7-6-11(2)13-8-9-18(4,24-21)10-15(13)14/h10-14,21H,5-9H2,1-4H3/p+1/t11-,12-,13+,14+,18-/m1/s1 |
| InChIKey | JCFRMZWFVQXHFG-NWBBNIOWSA-O |
| XLogP | 3.12 |
| TPSA | 84.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.42 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|