C23H34O4 — CID 134949450
methyl (1R,4R,5S)-3-acetyl-4-but-3-enyl-4-methyl-1-(3-methylbut-2-enyl)-2-oxo-5-prop-2-enylcyclohexane-1-carboxylate (PubChem CID 134949450) has the molecular formula C23H34O4 and a molecular weight of 374.52 g/mol. Its IUPAC name is methyl (1R,4R,5S)-3-acetyl-4-but-3-enyl-4-methyl-1-(3-methylbut-2-enyl)-2-oxo-5-prop-2-enylcyclohexane-1-carboxylate.
| Compound Name | methyl (1R,4R,5S)-3-acetyl-4-but-3-enyl-4-methyl-1-(3-methylbut-2-enyl)-2-oxo-5-prop-2-enylcyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 134949450 |
| Molecular Formula | C23H34O4 |
| Molecular Weight | 374.52 g/mol |
| Exact Mass | 374.25 |
| IUPAC Name | methyl (1R,4R,5S)-3-acetyl-4-but-3-enyl-4-methyl-1-(3-methylbut-2-enyl)-2-oxo-5-prop-2-enylcyclohexane-1-carboxylate |
| SMILES | C=CCC[C@@]1(C)C(C(C)=O)C(=O)[C@](CC=C(C)C)(C(=O)OC)C[C@@H]1CC=C |
| InChI | InChI=1S/C23H34O4/c1-8-10-13-22(6)18(11-9-2)15-23(21(26)27-7,14-12-16(3)4)20(25)19(22)17(5)24/h8-9,12,18-19H,1-2,10-11,13-15H2,3-7H3/t18-,19?,22+,23+/m0/s1 |
| InChIKey | ZEWXFNKCWIAYIB-MNYMTZRJSA-N |
| XLogP | 4.84 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.52 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|