C28H46O4Si — CID 134949589
[(1R,3S,5S,8S,10S)-8,12,15,15-tetramethyl-4-methylidene-13-oxo-10-triethylsilyloxy-5-tricyclo[9.3.1.03,8]pentadec-11-enyl] acetate (PubChem CID 134949589) has the molecular formula C28H46O4Si and a molecular weight of 474.76 g/mol. Its IUPAC name is [(1R,3S,5S,8S,10S)-8,12,15,15-tetramethyl-4-methylidene-13-oxo-10-triethylsilyloxy-5-tricyclo[9.3.1.03,8]pentadec-11-enyl] acetate.
| Compound Name | [(1R,3S,5S,8S,10S)-8,12,15,15-tetramethyl-4-methylidene-13-oxo-10-triethylsilyloxy-5-tricyclo[9.3.1.03,8]pentadec-11-enyl] acetate |
|---|---|
| PubChem CID | 134949589 |
| Molecular Formula | C28H46O4Si |
| Molecular Weight | 474.76 g/mol |
| Exact Mass | 474.32 |
| IUPAC Name | [(1R,3S,5S,8S,10S)-8,12,15,15-tetramethyl-4-methylidene-13-oxo-10-triethylsilyloxy-5-tricyclo[9.3.1.03,8]pentadec-11-enyl] acetate |
| SMILES | C=C1[C@@H](OC(C)=O)CC[C@@]2(C)C[C@H](O[Si](CC)(CC)CC)C3=C(C)C(=O)C[C@@H](C[C@H]12)C3(C)C |
| InChI | InChI=1S/C28H46O4Si/c1-10-33(11-2,12-3)32-25-17-28(9)14-13-24(31-20(6)29)18(4)22(28)15-21-16-23(30)19(5)26(25)27(21,7)8/h21-22,24-25H,4,10-17H2,1-3,5-9H3/t21-,22-,24+,25+,28+/m1/s1 |
| InChIKey | WHBXRAPRUIYGSF-FFKCXYFBSA-N |
| XLogP | 7.01 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.76 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|