C26H38O4 — CID 134949623
methyl (1R,3S,4R,5S)-3-acetyl-4-but-3-enyl-4-methyl-1-(3-methylbut-2-enyl)-2-oxo-3,5-bis(prop-2-enyl)cyclohexane-1-carboxylate (PubChem CID 134949623) has the molecular formula C26H38O4 and a molecular weight of 414.59 g/mol. Its IUPAC name is methyl (1R,3S,4R,5S)-3-acetyl-4-but-3-enyl-4-methyl-1-(3-methylbut-2-enyl)-2-oxo-3,5-bis(prop-2-enyl)cyclohexane-1-carboxylate.
| Compound Name | methyl (1R,3S,4R,5S)-3-acetyl-4-but-3-enyl-4-methyl-1-(3-methylbut-2-enyl)-2-oxo-3,5-bis(prop-2-enyl)cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 134949623 |
| Molecular Formula | C26H38O4 |
| Molecular Weight | 414.59 g/mol |
| Exact Mass | 414.28 |
| IUPAC Name | methyl (1R,3S,4R,5S)-3-acetyl-4-but-3-enyl-4-methyl-1-(3-methylbut-2-enyl)-2-oxo-3,5-bis(prop-2-enyl)cyclohexane-1-carboxylate |
| SMILES | C=CCC[C@]1(C)[C@@H](CC=C)C[C@@](CC=C(C)C)(C(=O)OC)C(=O)[C@]1(CC=C)C(C)=O |
| InChI | InChI=1S/C26H38O4/c1-9-12-16-24(7)21(13-10-2)18-25(23(29)30-8,17-14-19(4)5)22(28)26(24,15-11-3)20(6)27/h9-11,14,21H,1-3,12-13,15-18H2,4-8H3/t21-,24+,25+,26-/m0/s1 |
| InChIKey | GGNYJNJXVSYWBH-WSZJRCBQSA-N |
| XLogP | 5.79 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.59 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|