C22H24O5 — CID 134949654
methyl (8S,12S,13R,14R)-3-methoxy-17-oxo-12-(2-oxoethyl)-7,8,12,14,15,16-hexahydro-6H-cyclopenta[a]phenanthrene-13-carboxylate (PubChem CID 134949654) has the molecular formula C22H24O5 and a molecular weight of 368.43 g/mol. Its IUPAC name is methyl (8S,12S,13R,14R)-3-methoxy-17-oxo-12-(2-oxoethyl)-7,8,12,14,15,16-hexahydro-6H-cyclopenta[a]phenanthrene-13-carboxylate.
| Compound Name | methyl (8S,12S,13R,14R)-3-methoxy-17-oxo-12-(2-oxoethyl)-7,8,12,14,15,16-hexahydro-6H-cyclopenta[a]phenanthrene-13-carboxylate |
|---|---|
| PubChem CID | 134949654 |
| Molecular Formula | C22H24O5 |
| Molecular Weight | 368.43 g/mol |
| Exact Mass | 368.16 |
| IUPAC Name | methyl (8S,12S,13R,14R)-3-methoxy-17-oxo-12-(2-oxoethyl)-7,8,12,14,15,16-hexahydro-6H-cyclopenta[a]phenanthrene-13-carboxylate |
| SMILES | COC(=O)[C@@]12C(=O)CC[C@@H]1[C@@H]1CCc3cc(OC)ccc3C1=C[C@@H]2CC=O |
| InChI | InChI=1S/C22H24O5/c1-26-15-4-6-16-13(11-15)3-5-17-18(16)12-14(9-10-23)22(21(25)27-2)19(17)7-8-20(22)24/h4,6,10-12,14,17,19H,3,5,7-9H2,1-2H3/t14-,17+,19+,22+/m0/s1 |
| InChIKey | GWHVBIWTCUKPQE-MOSFLFPUSA-N |
| XLogP | 3.00 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.43 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|