C39H55F3O8 — CID 134949674
tert-butyl 3-[2,3,4-tris[3-[(2-methylpropan-2-yl)oxy]-3-oxopropyl]-6-(trifluoromethyl)naphthalen-1-yl]propanoate (PubChem CID 134949674) has the molecular formula C39H55F3O8 and a molecular weight of 708.86 g/mol. Its IUPAC name is tert-butyl 3-[2,3,4-tris[3-[(2-methylpropan-2-yl)oxy]-3-oxopropyl]-6-(trifluoromethyl)naphthalen-1-yl]propanoate.
| Compound Name | tert-butyl 3-[2,3,4-tris[3-[(2-methylpropan-2-yl)oxy]-3-oxopropyl]-6-(trifluoromethyl)naphthalen-1-yl]propanoate |
|---|---|
| PubChem CID | 134949674 |
| Molecular Formula | C39H55F3O8 |
| Molecular Weight | 708.86 g/mol |
| Exact Mass | 708.38 |
| IUPAC Name | tert-butyl 3-[2,3,4-tris[3-[(2-methylpropan-2-yl)oxy]-3-oxopropyl]-6-(trifluoromethyl)naphthalen-1-yl]propanoate |
| SMILES | CC(C)(C)OC(=O)CCc1c(CCC(=O)OC(C)(C)C)c(CCC(=O)OC(C)(C)C)c2cc(C(F)(F)F)ccc2c1CCC(=O)OC(C)(C)C |
| InChI | InChI=1S/C39H55F3O8/c1-35(2,3)47-31(43)19-15-25-26(16-20-32(44)48-36(4,5)6)28-14-13-24(39(40,41)42)23-30(28)29(18-22-34(46)50-38(10,11)12)27(25)17-21-33(45)49-37(7,8)9/h13-14,23H,15-22H2,1-12H3 |
| InChIKey | OXAUFAJTLMNKDQ-UHFFFAOYSA-N |
| XLogP | 8.96 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 708.86 |
| LogP ≤ 5 | 8.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|