About phenyl-[4-(2,2,2-trifluoroethyl)phenyl]diazene
phenyl-[4-(2,2,2-trifluoroethyl)phenyl]diazene (PubChem CID 134949761) has the molecular formula C14H11F3N2
and a molecular weight of 264.25 g/mol. Its IUPAC name is phenyl-[4-(2,2,2-trifluoroethyl)phenyl]diazene.
Molecular Properties
| Compound Name | phenyl-[4-(2,2,2-trifluoroethyl)phenyl]diazene |
| PubChem CID | 134949761 |
| Molecular Formula | C14H11F3N2 |
| Molecular Weight | 264.25 g/mol |
| Exact Mass | 264.09 |
| IUPAC Name | phenyl-[4-(2,2,2-trifluoroethyl)phenyl]diazene |
| SMILES | FC(F)(F)Cc1ccc(/N=N/c2ccccc2)cc1 |
| InChI | InChI=1S/C14H11F3N2/c15-14(16,17)10-11-6-8-13(9-7-11)19-18-12-4-2-1-3-5-12/h1-9H,10H2/b19-18+ |
| InChIKey | JSBYYWHYUVQMLR-VHEBQXMUSA-N |
| XLogP | 5.21 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 264.25 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze phenyl-[4-(2,2,2-trifluoroethyl)phenyl]diazene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenyl-[4-(2,2,2-trifluoroethyl)phenyl]diazene?
The IUPAC name of phenyl-[4-(2,2,2-trifluoroethyl)phenyl]diazene (CID 134949761) is phenyl-[4-(2,2,2-trifluoroethyl)phenyl]diazene.
What is the SMILES notation for phenyl-[4-(2,2,2-trifluoroethyl)phenyl]diazene?
The canonical SMILES for phenyl-[4-(2,2,2-trifluoroethyl)phenyl]diazene is FC(F)(F)Cc1ccc(/N=N/c2ccccc2)cc1.
What is the InChIKey of phenyl-[4-(2,2,2-trifluoroethyl)phenyl]diazene?
The InChIKey is JSBYYWHYUVQMLR-VHEBQXMUSA-N. The full InChI is InChI=1S/C14H11F3N2/c15-14(16,17)10-11-6-8-13(9-7-11)19-18-12-4-2-1-3-5-12/h1-9H,10H2/b19-18+.
What are the key properties of phenyl-[4-(2,2,2-trifluoroethyl)phenyl]diazene?
phenyl-[4-(2,2,2-trifluoroethyl)phenyl]diazene has a molecular weight of 264.25 g/mol, XLogP of 5.21, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for phenyl-[4-(2,2,2-trifluoroethyl)phenyl]diazene is sourced from PubChem (CID 134949761), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).