C22H40O4Si — CID 134949763
(3S,3aS,4aR,6S,7S,7aR,8aS)-3,4a-dimethyl-7-propan-2-yl-6-(2-trimethylsilylethoxymethoxy)-3a,4,5,6,7,7a,8,8a-octahydro-3H-cyclopenta[f][1]benzofuran-2-one (PubChem CID 134949763) has the molecular formula C22H40O4Si and a molecular weight of 396.64 g/mol. Its IUPAC name is (3S,3aS,4aR,6S,7S,7aR,8aS)-3,4a-dimethyl-7-propan-2-yl-6-(2-trimethylsilylethoxymethoxy)-3a,4,5,6,7,7a,8,8a-octahydro-3H-cyclopenta[f][1]benzofuran-2-one.
| Compound Name | (3S,3aS,4aR,6S,7S,7aR,8aS)-3,4a-dimethyl-7-propan-2-yl-6-(2-trimethylsilylethoxymethoxy)-3a,4,5,6,7,7a,8,8a-octahydro-3H-cyclopenta[f][1]benzofuran-2-one |
|---|---|
| PubChem CID | 134949763 |
| Molecular Formula | C22H40O4Si |
| Molecular Weight | 396.64 g/mol |
| Exact Mass | 396.27 |
| IUPAC Name | (3S,3aS,4aR,6S,7S,7aR,8aS)-3,4a-dimethyl-7-propan-2-yl-6-(2-trimethylsilylethoxymethoxy)-3a,4,5,6,7,7a,8,8a-octahydro-3H-cyclopenta[f][1]benzofuran-2-one |
| SMILES | CC(C)[C@@H]1[C@@H](OCOCC[Si](C)(C)C)C[C@@]2(C)C[C@@H]3[C@H](C[C@H]12)OC(=O)[C@H]3C |
| InChI | InChI=1S/C22H40O4Si/c1-14(2)20-17-10-18-16(15(3)21(23)26-18)11-22(17,4)12-19(20)25-13-24-8-9-27(5,6)7/h14-20H,8-13H2,1-7H3/t15-,16-,17+,18-,19-,20-,22+/m0/s1 |
| InChIKey | CQSHVNBWDXFKPL-DEAJMQISSA-N |
| XLogP | 4.95 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.64 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|