C24H44O3Si — CID 134949905
(3S,6R)-6-[(1E,3S,6R,7E)-6-[tert-butyl(dimethyl)silyl]oxy-3,7-dimethyldeca-1,7,9-trienyl]-3-methyloxan-2-ol (PubChem CID 134949905) has the molecular formula C24H44O3Si and a molecular weight of 408.70 g/mol. Its IUPAC name is (3S,6R)-6-[(1E,3S,6R,7E)-6-[tert-butyl(dimethyl)silyl]oxy-3,7-dimethyldeca-1,7,9-trienyl]-3-methyloxan-2-ol.
| Compound Name | (3S,6R)-6-[(1E,3S,6R,7E)-6-[tert-butyl(dimethyl)silyl]oxy-3,7-dimethyldeca-1,7,9-trienyl]-3-methyloxan-2-ol |
|---|---|
| PubChem CID | 134949905 |
| Molecular Formula | C24H44O3Si |
| Molecular Weight | 408.70 g/mol |
| Exact Mass | 408.31 |
| IUPAC Name | (3S,6R)-6-[(1E,3S,6R,7E)-6-[tert-butyl(dimethyl)silyl]oxy-3,7-dimethyldeca-1,7,9-trienyl]-3-methyloxan-2-ol |
| SMILES | C=C/C=C(\C)[C@@H](CC[C@H](C)/C=C/[C@H]1CC[C@H](C)C(O)O1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C24H44O3Si/c1-10-11-19(3)22(27-28(8,9)24(5,6)7)17-13-18(2)12-15-21-16-14-20(4)23(25)26-21/h10-12,15,18,20-23,25H,1,13-14,16-17H2,2-9H3/b15-12+,19-11+/t18-,20+,21+,22-,23?/m1/s1 |
| InChIKey | HTAWOQNZJDVFQM-WDWJIODASA-N |
| XLogP | 6.62 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.70 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|