About benzyl 4-(2-azidophenyl)-3,6-dihydro-2H-pyridine-1-carboxylate
benzyl 4-(2-azidophenyl)-3,6-dihydro-2H-pyridine-1-carboxylate (PubChem CID 134949953) has the molecular formula C19H18N4O2
and a molecular weight of 334.38 g/mol. Its IUPAC name is benzyl 4-(2-azidophenyl)-3,6-dihydro-2H-pyridine-1-carboxylate.
Molecular Properties
| Compound Name | benzyl 4-(2-azidophenyl)-3,6-dihydro-2H-pyridine-1-carboxylate |
| PubChem CID | 134949953 |
| Molecular Formula | C19H18N4O2 |
| Molecular Weight | 334.38 g/mol |
| Exact Mass | 334.14 |
| IUPAC Name | benzyl 4-(2-azidophenyl)-3,6-dihydro-2H-pyridine-1-carboxylate |
| SMILES | [N-]=[N+]=Nc1ccccc1C1=CCN(C(=O)OCc2ccccc2)CC1 |
| InChI | InChI=1S/C19H18N4O2/c20-22-21-18-9-5-4-8-17(18)16-10-12-23(13-11-16)19(24)25-14-15-6-2-1-3-7-15/h1-10H,11-14H2 |
| InChIKey | PRDZUOARUYUKAA-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 78.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 334.38 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze benzyl 4-(2-azidophenyl)-3,6-dihydro-2H-pyridine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl 4-(2-azidophenyl)-3,6-dihydro-2H-pyridine-1-carboxylate?
The IUPAC name of benzyl 4-(2-azidophenyl)-3,6-dihydro-2H-pyridine-1-carboxylate (CID 134949953) is benzyl 4-(2-azidophenyl)-3,6-dihydro-2H-pyridine-1-carboxylate.
What is the SMILES notation for benzyl 4-(2-azidophenyl)-3,6-dihydro-2H-pyridine-1-carboxylate?
The canonical SMILES for benzyl 4-(2-azidophenyl)-3,6-dihydro-2H-pyridine-1-carboxylate is [N-]=[N+]=Nc1ccccc1C1=CCN(C(=O)OCc2ccccc2)CC1.
What is the InChIKey of benzyl 4-(2-azidophenyl)-3,6-dihydro-2H-pyridine-1-carboxylate?
The InChIKey is PRDZUOARUYUKAA-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H18N4O2/c20-22-21-18-9-5-4-8-17(18)16-10-12-23(13-11-16)19(24)25-14-15-6-2-1-3-7-15/h1-10H,11-14H2.
What are the key properties of benzyl 4-(2-azidophenyl)-3,6-dihydro-2H-pyridine-1-carboxylate?
benzyl 4-(2-azidophenyl)-3,6-dihydro-2H-pyridine-1-carboxylate has a molecular weight of 334.38 g/mol, XLogP of 5.05, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl 4-(2-azidophenyl)-3,6-dihydro-2H-pyridine-1-carboxylate is sourced from PubChem (CID 134949953), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).