C26H24N2O2S — CID 134949956
(3R)-N,N-dibenzyl-3-[(2S)-5-oxo-2H-furan-2-yl]-3-pyridin-3-ylpropanethioamide (PubChem CID 134949956) has the molecular formula C26H24N2O2S and a molecular weight of 428.56 g/mol. Its IUPAC name is (3R)-N,N-dibenzyl-3-[(2S)-5-oxo-2H-furan-2-yl]-3-pyridin-3-ylpropanethioamide.
| Compound Name | (3R)-N,N-dibenzyl-3-[(2S)-5-oxo-2H-furan-2-yl]-3-pyridin-3-ylpropanethioamide |
|---|---|
| PubChem CID | 134949956 |
| Molecular Formula | C26H24N2O2S |
| Molecular Weight | 428.56 g/mol |
| Exact Mass | 428.16 |
| IUPAC Name | (3R)-N,N-dibenzyl-3-[(2S)-5-oxo-2H-furan-2-yl]-3-pyridin-3-ylpropanethioamide |
| SMILES | O=C1C=C[C@@H]([C@H](CC(=S)N(Cc2ccccc2)Cc2ccccc2)c2cccnc2)O1 |
| InChI | InChI=1S/C26H24N2O2S/c29-26-14-13-24(30-26)23(22-12-7-15-27-17-22)16-25(31)28(18-20-8-3-1-4-9-20)19-21-10-5-2-6-11-21/h1-15,17,23-24H,16,18-19H2/t23-,24+/m1/s1 |
| InChIKey | BAZJVPIAUZMXJR-RPWUZVMVSA-N |
| XLogP | 5.07 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.56 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|