About (3R)-N,N-dibenzyl-3-[(2S)-5-oxo-2H-furan-2-yl]-3-pyridin-3-ylpropanethioamide
(3R)-N,N-dibenzyl-3-[(2S)-5-oxo-2H-furan-2-yl]-3-pyridin-3-ylpropanethioamide (PubChem CID 134949956) has the molecular formula C26H24N2O2S
and a molecular weight of 428.56 g/mol. Its IUPAC name is (3R)-N,N-dibenzyl-3-[(2S)-5-oxo-2H-furan-2-yl]-3-pyridin-3-ylpropanethioamide.
Molecular Properties
| Compound Name | (3R)-N,N-dibenzyl-3-[(2S)-5-oxo-2H-furan-2-yl]-3-pyridin-3-ylpropanethioamide |
| PubChem CID | 134949956 |
| Molecular Formula | C26H24N2O2S |
| Molecular Weight | 428.56 g/mol |
| Exact Mass | 428.16 |
| IUPAC Name | (3R)-N,N-dibenzyl-3-[(2S)-5-oxo-2H-furan-2-yl]-3-pyridin-3-ylpropanethioamide |
| SMILES | O=C1C=C[C@@H]([C@H](CC(=S)N(Cc2ccccc2)Cc2ccccc2)c2cccnc2)O1 |
| InChI | InChI=1S/C26H24N2O2S/c29-26-14-13-24(30-26)23(22-12-7-15-27-17-22)16-25(31)28(18-20-8-3-1-4-9-20)19-21-10-5-2-6-11-21/h1-15,17,23-24H,16,18-19H2/t23-,24+/m1/s1 |
| InChIKey | BAZJVPIAUZMXJR-RPWUZVMVSA-N |
| XLogP | 5.07 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 428.56 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze (3R)-N,N-dibenzyl-3-[(2S)-5-oxo-2H-furan-2-yl]-3-pyridin-3-ylpropanethioamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-N,N-dibenzyl-3-[(2S)-5-oxo-2H-furan-2-yl]-3-pyridin-3-ylpropanethioamide?
The IUPAC name of (3R)-N,N-dibenzyl-3-[(2S)-5-oxo-2H-furan-2-yl]-3-pyridin-3-ylpropanethioamide (CID 134949956) is (3R)-N,N-dibenzyl-3-[(2S)-5-oxo-2H-furan-2-yl]-3-pyridin-3-ylpropanethioamide.
What is the SMILES notation for (3R)-N,N-dibenzyl-3-[(2S)-5-oxo-2H-furan-2-yl]-3-pyridin-3-ylpropanethioamide?
The canonical SMILES for (3R)-N,N-dibenzyl-3-[(2S)-5-oxo-2H-furan-2-yl]-3-pyridin-3-ylpropanethioamide is O=C1C=C[C@@H]([C@H](CC(=S)N(Cc2ccccc2)Cc2ccccc2)c2cccnc2)O1.
What is the InChIKey of (3R)-N,N-dibenzyl-3-[(2S)-5-oxo-2H-furan-2-yl]-3-pyridin-3-ylpropanethioamide?
The InChIKey is BAZJVPIAUZMXJR-RPWUZVMVSA-N. The full InChI is InChI=1S/C26H24N2O2S/c29-26-14-13-24(30-26)23(22-12-7-15-27-17-22)16-25(31)28(18-20-8-3-1-4-9-20)19-21-10-5-2-6-11-21/h1-15,17,23-24H,16,18-19H2/t23-,24+/m1/s1.
What are the key properties of (3R)-N,N-dibenzyl-3-[(2S)-5-oxo-2H-furan-2-yl]-3-pyridin-3-ylpropanethioamide?
(3R)-N,N-dibenzyl-3-[(2S)-5-oxo-2H-furan-2-yl]-3-pyridin-3-ylpropanethioamide has a molecular weight of 428.56 g/mol, XLogP of 5.07, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-N,N-dibenzyl-3-[(2S)-5-oxo-2H-furan-2-yl]-3-pyridin-3-ylpropanethioamide is sourced from PubChem (CID 134949956), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).