About 3,4-dimethyl-3,4-dihydro-2H-quinolin-2-ide;rutherfordium
3,4-dimethyl-3,4-dihydro-2H-quinolin-2-ide;rutherfordium (PubChem CID 134949989) has the molecular formula C11H12NRf-
and a molecular weight of 425.22 g/mol. Its IUPAC name is 3,4-dimethyl-3,4-dihydro-2H-quinolin-2-ide;rutherfordium.
Molecular Properties
| Compound Name | 3,4-dimethyl-3,4-dihydro-2H-quinolin-2-ide;rutherfordium |
| PubChem CID | 134949989 |
| Molecular Formula | C11H12NRf- |
| Molecular Weight | 425.22 g/mol |
| Exact Mass | 425.22 |
| IUPAC Name | 3,4-dimethyl-3,4-dihydro-2H-quinolin-2-ide;rutherfordium |
| SMILES | CC1[C-]=Nc2ccccc2C1C.[Rf] |
| InChI | InChI=1S/C11H12N.Rf/c1-8-7-12-11-6-4-3-5-10(11)9(8)2;/h3-6,8-9H,1-2H3;/q-1; |
| InChIKey | UPUDNFMWGXYPMV-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 425.22 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 3,4-dimethyl-3,4-dihydro-2H-quinolin-2-ide;rutherfordium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-dimethyl-3,4-dihydro-2H-quinolin-2-ide;rutherfordium?
The IUPAC name of 3,4-dimethyl-3,4-dihydro-2H-quinolin-2-ide;rutherfordium (CID 134949989) is 3,4-dimethyl-3,4-dihydro-2H-quinolin-2-ide;rutherfordium.
What is the SMILES notation for 3,4-dimethyl-3,4-dihydro-2H-quinolin-2-ide;rutherfordium?
The canonical SMILES for 3,4-dimethyl-3,4-dihydro-2H-quinolin-2-ide;rutherfordium is CC1[C-]=Nc2ccccc2C1C.[Rf].
What is the InChIKey of 3,4-dimethyl-3,4-dihydro-2H-quinolin-2-ide;rutherfordium?
The InChIKey is UPUDNFMWGXYPMV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12N.Rf/c1-8-7-12-11-6-4-3-5-10(11)9(8)2;/h3-6,8-9H,1-2H3;/q-1;.
What are the key properties of 3,4-dimethyl-3,4-dihydro-2H-quinolin-2-ide;rutherfordium?
3,4-dimethyl-3,4-dihydro-2H-quinolin-2-ide;rutherfordium has a molecular weight of 425.22 g/mol, XLogP of 3.02, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-dimethyl-3,4-dihydro-2H-quinolin-2-ide;rutherfordium is sourced from PubChem (CID 134949989), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).