About 1-[(3R)-3-ethenyl-2,3-dihydroindolizin-1-yl]ethanone
1-[(3R)-3-ethenyl-2,3-dihydroindolizin-1-yl]ethanone (PubChem CID 134950025) has the molecular formula C12H13NO
and a molecular weight of 187.24 g/mol. Its IUPAC name is 1-[(3R)-3-ethenyl-2,3-dihydroindolizin-1-yl]ethanone.
Molecular Properties
| Compound Name | 1-[(3R)-3-ethenyl-2,3-dihydroindolizin-1-yl]ethanone |
| PubChem CID | 134950025 |
| Molecular Formula | C12H13NO |
| Molecular Weight | 187.24 g/mol |
| Exact Mass | 187.10 |
| IUPAC Name | 1-[(3R)-3-ethenyl-2,3-dihydroindolizin-1-yl]ethanone |
| SMILES | C=C[C@H]1CC(C(C)=O)=C2C=CC=CN21 |
| InChI | InChI=1S/C12H13NO/c1-3-10-8-11(9(2)14)12-6-4-5-7-13(10)12/h3-7,10H,1,8H2,2H3/t10-/m0/s1 |
| InChIKey | IXQZMZOXQOMIIJ-JTQLQIEISA-N |
| XLogP | 2.17 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.24 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-[(3R)-3-ethenyl-2,3-dihydroindolizin-1-yl]ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(3R)-3-ethenyl-2,3-dihydroindolizin-1-yl]ethanone?
The IUPAC name of 1-[(3R)-3-ethenyl-2,3-dihydroindolizin-1-yl]ethanone (CID 134950025) is 1-[(3R)-3-ethenyl-2,3-dihydroindolizin-1-yl]ethanone.
What is the SMILES notation for 1-[(3R)-3-ethenyl-2,3-dihydroindolizin-1-yl]ethanone?
The canonical SMILES for 1-[(3R)-3-ethenyl-2,3-dihydroindolizin-1-yl]ethanone is C=C[C@H]1CC(C(C)=O)=C2C=CC=CN21.
What is the InChIKey of 1-[(3R)-3-ethenyl-2,3-dihydroindolizin-1-yl]ethanone?
The InChIKey is IXQZMZOXQOMIIJ-JTQLQIEISA-N. The full InChI is InChI=1S/C12H13NO/c1-3-10-8-11(9(2)14)12-6-4-5-7-13(10)12/h3-7,10H,1,8H2,2H3/t10-/m0/s1.
What are the key properties of 1-[(3R)-3-ethenyl-2,3-dihydroindolizin-1-yl]ethanone?
1-[(3R)-3-ethenyl-2,3-dihydroindolizin-1-yl]ethanone has a molecular weight of 187.24 g/mol, XLogP of 2.17, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(3R)-3-ethenyl-2,3-dihydroindolizin-1-yl]ethanone is sourced from PubChem (CID 134950025), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).