C20H28F2O3Si — CID 134950297
ethyl 2-[(1S,2R)-1-[tert-butyl(dimethyl)silyl]oxy-6,7-difluoro-1,2-dihydronaphthalen-2-yl]acetate (PubChem CID 134950297) has the molecular formula C20H28F2O3Si and a molecular weight of 382.52 g/mol. Its IUPAC name is ethyl 2-[(1S,2R)-1-[tert-butyl(dimethyl)silyl]oxy-6,7-difluoro-1,2-dihydronaphthalen-2-yl]acetate.
| Compound Name | ethyl 2-[(1S,2R)-1-[tert-butyl(dimethyl)silyl]oxy-6,7-difluoro-1,2-dihydronaphthalen-2-yl]acetate |
|---|---|
| PubChem CID | 134950297 |
| Molecular Formula | C20H28F2O3Si |
| Molecular Weight | 382.52 g/mol |
| Exact Mass | 382.18 |
| IUPAC Name | ethyl 2-[(1S,2R)-1-[tert-butyl(dimethyl)silyl]oxy-6,7-difluoro-1,2-dihydronaphthalen-2-yl]acetate |
| SMILES | CCOC(=O)C[C@@H]1C=Cc2cc(F)c(F)cc2[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C20H28F2O3Si/c1-7-24-18(23)11-14-9-8-13-10-16(21)17(22)12-15(13)19(14)25-26(5,6)20(2,3)4/h8-10,12,14,19H,7,11H2,1-6H3/t14-,19-/m0/s1 |
| InChIKey | RDBVXDIDPKWCHL-LIRRHRJNSA-N |
| XLogP | 5.62 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.52 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|