C18H13F3N2O2 — CID 134950339
2-[(S)-[5-(2-oxopropyl)furan-2-yl]-[4-(trifluoromethyl)phenyl]methyl]propanedinitrile (PubChem CID 134950339) has the molecular formula C18H13F3N2O2 and a molecular weight of 346.31 g/mol. Its IUPAC name is 2-[(S)-[5-(2-oxopropyl)furan-2-yl]-[4-(trifluoromethyl)phenyl]methyl]propanedinitrile.
| Compound Name | 2-[(S)-[5-(2-oxopropyl)furan-2-yl]-[4-(trifluoromethyl)phenyl]methyl]propanedinitrile |
|---|---|
| PubChem CID | 134950339 |
| Molecular Formula | C18H13F3N2O2 |
| Molecular Weight | 346.31 g/mol |
| Exact Mass | 346.09 |
| IUPAC Name | 2-[(S)-[5-(2-oxopropyl)furan-2-yl]-[4-(trifluoromethyl)phenyl]methyl]propanedinitrile |
| SMILES | CC(=O)Cc1ccc([C@H](c2ccc(C(F)(F)F)cc2)C(C#N)C#N)o1 |
| InChI | InChI=1S/C18H13F3N2O2/c1-11(24)8-15-6-7-16(25-15)17(13(9-22)10-23)12-2-4-14(5-3-12)18(19,20)21/h2-7,13,17H,8H2,1H3/t17-/m1/s1 |
| InChIKey | QBCILYFETJOESH-QGZVFWFLSA-N |
| XLogP | 4.23 |
| TPSA | 77.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.31 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |