C23H24NOPS — CID 134950360
(NE,R)-N-[(2-diphenylphosphanylphenyl)methylidene]-2-methylpropane-2-sulfinamide (PubChem CID 134950360) has the molecular formula C23H24NOPS and a molecular weight of 393.49 g/mol. Its IUPAC name is (NE,R)-N-[(2-diphenylphosphanylphenyl)methylidene]-2-methylpropane-2-sulfinamide.
| Compound Name | (NE,R)-N-[(2-diphenylphosphanylphenyl)methylidene]-2-methylpropane-2-sulfinamide |
|---|---|
| PubChem CID | 134950360 |
| Molecular Formula | C23H24NOPS |
| Molecular Weight | 393.49 g/mol |
| Exact Mass | 393.13 |
| IUPAC Name | (NE,R)-N-[(2-diphenylphosphanylphenyl)methylidene]-2-methylpropane-2-sulfinamide |
| SMILES | CC(C)(C)[S@@](=O)/N=C/c1ccccc1P(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H24NOPS/c1-23(2,3)27(25)24-18-19-12-10-11-17-22(19)26(20-13-6-4-7-14-20)21-15-8-5-9-16-21/h4-18H,1-3H3/b24-18+/t27-/m1/s1 |
| InChIKey | CEWJNABQVQXHHW-WTDOPDLHSA-N |
| XLogP | 4.33 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.49 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|