C29H51NO5Si — CID 134950440
[(3Z,5S,6S,7R,9S,11Z,13S,14R,15R)-14-[tert-butyl(dimethyl)silyl]oxy-5,7,9,11,13,15-hexamethyl-8,16-dioxohexadeca-1,3,11-trien-6-yl] carbamate (PubChem CID 134950440) has the molecular formula C29H51NO5Si and a molecular weight of 521.82 g/mol. Its IUPAC name is [(3Z,5S,6S,7R,9S,11Z,13S,14R,15R)-14-[tert-butyl(dimethyl)silyl]oxy-5,7,9,11,13,15-hexamethyl-8,16-dioxohexadeca-1,3,11-trien-6-yl] carbamate.
| Compound Name | [(3Z,5S,6S,7R,9S,11Z,13S,14R,15R)-14-[tert-butyl(dimethyl)silyl]oxy-5,7,9,11,13,15-hexamethyl-8,16-dioxohexadeca-1,3,11-trien-6-yl] carbamate |
|---|---|
| PubChem CID | 134950440 |
| Molecular Formula | C29H51NO5Si |
| Molecular Weight | 521.82 g/mol |
| Exact Mass | 521.35 |
| IUPAC Name | [(3Z,5S,6S,7R,9S,11Z,13S,14R,15R)-14-[tert-butyl(dimethyl)silyl]oxy-5,7,9,11,13,15-hexamethyl-8,16-dioxohexadeca-1,3,11-trien-6-yl] carbamate |
| SMILES | C=C/C=C\[C@H](C)[C@H](OC(N)=O)[C@@H](C)C(=O)[C@@H](C)C/C(C)=C\[C@H](C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)C=O |
| InChI | InChI=1S/C29H51NO5Si/c1-13-14-15-20(3)27(34-28(30)33)24(7)25(32)21(4)16-19(2)17-22(5)26(23(6)18-31)35-36(11,12)29(8,9)10/h13-15,17-18,20-24,26-27H,1,16H2,2-12H3,(H2,30,33)/b15-14-,19-17-/t20-,21-,22-,23-,24-,26+,27-/m0/s1 |
| InChIKey | QFUMZEAPXGZVTH-HWVGYVDWSA-N |
| XLogP | 6.87 |
| TPSA | 95.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.82 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|