C17H27O3Si+ — CID 134950527
[2-(3,4-dihydro-1H-isochromen-1-yl)-2-methyl-1-trimethylsilyloxypropylidene]-methyloxidanium (PubChem CID 134950527) has the molecular formula C17H27O3Si+ and a molecular weight of 307.49 g/mol. Its IUPAC name is [2-(3,4-dihydro-1H-isochromen-1-yl)-2-methyl-1-trimethylsilyloxypropylidene]-methyloxidanium.
| Compound Name | [2-(3,4-dihydro-1H-isochromen-1-yl)-2-methyl-1-trimethylsilyloxypropylidene]-methyloxidanium |
|---|---|
| PubChem CID | 134950527 |
| Molecular Formula | C17H27O3Si+ |
| Molecular Weight | 307.49 g/mol |
| Exact Mass | 307.17 |
| IUPAC Name | [2-(3,4-dihydro-1H-isochromen-1-yl)-2-methyl-1-trimethylsilyloxypropylidene]-methyloxidanium |
| SMILES | C/[O+]=C(\O[Si](C)(C)C)C(C)(C)C1OCCc2ccccc21 |
| InChI | InChI=1S/C17H27O3Si/c1-17(2,16(18-3)20-21(4,5)6)15-14-10-8-7-9-13(14)11-12-19-15/h7-10,15H,11-12H2,1-6H3/q+1 |
| InChIKey | HWPOEANKVPMWFW-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 29.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.49 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|