C12H11F2NS — CID 134950577
2-[difluoro(phenyl)methyl]-4,5-dimethyl-1,3-thiazole (PubChem CID 134950577) has the molecular formula C12H11F2NS and a molecular weight of 239.29 g/mol. Its IUPAC name is 2-[difluoro(phenyl)methyl]-4,5-dimethyl-1,3-thiazole.
| Compound Name | 2-[difluoro(phenyl)methyl]-4,5-dimethyl-1,3-thiazole |
|---|---|
| PubChem CID | 134950577 |
| Molecular Formula | C12H11F2NS |
| Molecular Weight | 239.29 g/mol |
| Exact Mass | 239.06 |
| IUPAC Name | 2-[difluoro(phenyl)methyl]-4,5-dimethyl-1,3-thiazole |
| SMILES | Cc1nc(C(F)(F)c2ccccc2)sc1C |
| InChI | InChI=1S/C12H11F2NS/c1-8-9(2)16-11(15-8)12(13,14)10-6-4-3-5-7-10/h3-7H,1-2H3 |
| InChIKey | KPLLFUUUOPHKOT-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.29 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |