C28H39F3O2Si — CID 134950613
tert-butyl-[(E)-6-(4-methoxyphenyl)-2,2-dimethyl-5-[4-(trifluoromethyl)phenyl]hex-3-enoxy]-dimethylsilane (PubChem CID 134950613) has the molecular formula C28H39F3O2Si and a molecular weight of 492.70 g/mol. Its IUPAC name is tert-butyl-[(E)-6-(4-methoxyphenyl)-2,2-dimethyl-5-[4-(trifluoromethyl)phenyl]hex-3-enoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(E)-6-(4-methoxyphenyl)-2,2-dimethyl-5-[4-(trifluoromethyl)phenyl]hex-3-enoxy]-dimethylsilane |
|---|---|
| PubChem CID | 134950613 |
| Molecular Formula | C28H39F3O2Si |
| Molecular Weight | 492.70 g/mol |
| Exact Mass | 492.27 |
| IUPAC Name | tert-butyl-[(E)-6-(4-methoxyphenyl)-2,2-dimethyl-5-[4-(trifluoromethyl)phenyl]hex-3-enoxy]-dimethylsilane |
| SMILES | COc1ccc(CC(/C=C/C(C)(C)CO[Si](C)(C)C(C)(C)C)c2ccc(C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C28H39F3O2Si/c1-26(2,3)34(7,8)33-20-27(4,5)18-17-23(19-21-9-15-25(32-6)16-10-21)22-11-13-24(14-12-22)28(29,30)31/h9-18,23H,19-20H2,1-8H3/b18-17+ |
| InChIKey | UOGABZXXQFXPGZ-ISLYRVAYSA-N |
| XLogP | 8.64 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.70 |
| LogP ≤ 5 | 8.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|