C20H24O2 — CID 134950676
(1S,2R)-2-(2-phenylethynyl)-1-[(4S)-4-prop-1-en-2-ylcyclohexen-1-yl]propane-1,3-diol (PubChem CID 134950676) has the molecular formula C20H24O2 and a molecular weight of 296.41 g/mol. Its IUPAC name is (1S,2R)-2-(2-phenylethynyl)-1-[(4S)-4-prop-1-en-2-ylcyclohexen-1-yl]propane-1,3-diol.
| Compound Name | (1S,2R)-2-(2-phenylethynyl)-1-[(4S)-4-prop-1-en-2-ylcyclohexen-1-yl]propane-1,3-diol |
|---|---|
| PubChem CID | 134950676 |
| Molecular Formula | C20H24O2 |
| Molecular Weight | 296.41 g/mol |
| Exact Mass | 296.18 |
| IUPAC Name | (1S,2R)-2-(2-phenylethynyl)-1-[(4S)-4-prop-1-en-2-ylcyclohexen-1-yl]propane-1,3-diol |
| SMILES | C=C(C)[C@@H]1CC=C([C@@H](O)[C@H](C#Cc2ccccc2)CO)CC1 |
| InChI | InChI=1S/C20H24O2/c1-15(2)17-10-12-18(13-11-17)20(22)19(14-21)9-8-16-6-4-3-5-7-16/h3-7,12,17,19-22H,1,10-11,13-14H2,2H3/t17-,19-,20-/m1/s1 |
| InChIKey | RNKSUHLUNNVEOQ-MISYRCLQSA-N |
| XLogP | 3.31 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.41 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|