C26H20ClNO3 — CID 134950718
(2S,3S,4S)-1'-acetyl-5'-chloro-3,4-diphenylspiro[cyclopentane-2,2'-indole]-1,3'-dione (PubChem CID 134950718) has the molecular formula C26H20ClNO3 and a molecular weight of 429.90 g/mol. Its IUPAC name is (2S,3S,4S)-1'-acetyl-5'-chloro-3,4-diphenylspiro[cyclopentane-2,2'-indole]-1,3'-dione.
| Compound Name | (2S,3S,4S)-1'-acetyl-5'-chloro-3,4-diphenylspiro[cyclopentane-2,2'-indole]-1,3'-dione |
|---|---|
| PubChem CID | 134950718 |
| Molecular Formula | C26H20ClNO3 |
| Molecular Weight | 429.90 g/mol |
| Exact Mass | 429.11 |
| IUPAC Name | (2S,3S,4S)-1'-acetyl-5'-chloro-3,4-diphenylspiro[cyclopentane-2,2'-indole]-1,3'-dione |
| SMILES | CC(=O)N1c2ccc(Cl)cc2C(=O)[C@]12C(=O)C[C@H](c1ccccc1)[C@H]2c1ccccc1 |
| InChI | InChI=1S/C26H20ClNO3/c1-16(29)28-22-13-12-19(27)14-21(22)25(31)26(28)23(30)15-20(17-8-4-2-5-9-17)24(26)18-10-6-3-7-11-18/h2-14,20,24H,15H2,1H3/t20-,24-,26-/m1/s1 |
| InChIKey | CYSRDMJZZNWJAQ-OLLUBJOZSA-N |
| XLogP | 5.17 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.90 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|