C22H21NO3 — CID 134950781
ethyl (2R,3R,4S)-3-cyano-4-ethenyl-2,4-diphenyloxolane-3-carboxylate (PubChem CID 134950781) has the molecular formula C22H21NO3 and a molecular weight of 347.41 g/mol. Its IUPAC name is ethyl (2R,3R,4S)-3-cyano-4-ethenyl-2,4-diphenyloxolane-3-carboxylate.
| Compound Name | ethyl (2R,3R,4S)-3-cyano-4-ethenyl-2,4-diphenyloxolane-3-carboxylate |
|---|---|
| PubChem CID | 134950781 |
| Molecular Formula | C22H21NO3 |
| Molecular Weight | 347.41 g/mol |
| Exact Mass | 347.15 |
| IUPAC Name | ethyl (2R,3R,4S)-3-cyano-4-ethenyl-2,4-diphenyloxolane-3-carboxylate |
| SMILES | C=C[C@@]1(c2ccccc2)CO[C@H](c2ccccc2)[C@@]1(C#N)C(=O)OCC |
| InChI | InChI=1S/C22H21NO3/c1-3-21(18-13-9-6-10-14-18)16-26-19(17-11-7-5-8-12-17)22(21,15-23)20(24)25-4-2/h3,5-14,19H,1,4,16H2,2H3/t19-,21+,22+/m1/s1 |
| InChIKey | VFJVTRIEWQHMQW-HJNYFJLDSA-N |
| XLogP | 3.95 |
| TPSA | 59.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.41 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|