C20H30O5 — CID 134951097
(1S,2R,3R,6R,7S,9R,10R,12S,14S)-7,12-dihydroxy-2,6,10-trimethyl-14-(2-methylprop-1-enyl)-13,15-dioxatetracyclo[8.3.2.01,9.03,7]pentadecan-8-one (PubChem CID 134951097) has the molecular formula C20H30O5 and a molecular weight of 350.46 g/mol. Its IUPAC name is (1S,2R,3R,6R,7S,9R,10R,12S,14S)-7,12-dihydroxy-2,6,10-trimethyl-14-(2-methylprop-1-enyl)-13,15-dioxatetracyclo[8.3.2.01,9.03,7]pentadecan-8-one.
| Compound Name | (1S,2R,3R,6R,7S,9R,10R,12S,14S)-7,12-dihydroxy-2,6,10-trimethyl-14-(2-methylprop-1-enyl)-13,15-dioxatetracyclo[8.3.2.01,9.03,7]pentadecan-8-one |
|---|---|
| PubChem CID | 134951097 |
| Molecular Formula | C20H30O5 |
| Molecular Weight | 350.46 g/mol |
| Exact Mass | 350.21 |
| IUPAC Name | (1S,2R,3R,6R,7S,9R,10R,12S,14S)-7,12-dihydroxy-2,6,10-trimethyl-14-(2-methylprop-1-enyl)-13,15-dioxatetracyclo[8.3.2.01,9.03,7]pentadecan-8-one |
| SMILES | CC(C)=C[C@@H]1O[C@]2(C)C[C@@H](O)O[C@]13[C@H](C)[C@H]1CC[C@@H](C)[C@@]1(O)C(=O)[C@@H]32 |
| InChI | InChI=1S/C20H30O5/c1-10(2)8-14-20-12(4)13-7-6-11(3)19(13,23)17(22)16(20)18(5,24-14)9-15(21)25-20/h8,11-16,21,23H,6-7,9H2,1-5H3/t11-,12-,13-,14+,15+,16-,18-,19+,20-/m1/s1 |
| InChIKey | CVPRVMFLHNNGRF-HFXNXFSKSA-N |
| XLogP | 2.20 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.46 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|