C20H36O4Si — CID 134951152
1-[(4aR,8R,8aS)-2,2-ditert-butyl-4,4a,8,8a-tetrahydropyrano[3,2-d][1,3,2]dioxasilin-8-yl]cyclohexan-1-ol (PubChem CID 134951152) has the molecular formula C20H36O4Si and a molecular weight of 368.59 g/mol. Its IUPAC name is 1-[(4aR,8R,8aS)-2,2-ditert-butyl-4,4a,8,8a-tetrahydropyrano[3,2-d][1,3,2]dioxasilin-8-yl]cyclohexan-1-ol.
| Compound Name | 1-[(4aR,8R,8aS)-2,2-ditert-butyl-4,4a,8,8a-tetrahydropyrano[3,2-d][1,3,2]dioxasilin-8-yl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 134951152 |
| Molecular Formula | C20H36O4Si |
| Molecular Weight | 368.59 g/mol |
| Exact Mass | 368.24 |
| IUPAC Name | 1-[(4aR,8R,8aS)-2,2-ditert-butyl-4,4a,8,8a-tetrahydropyrano[3,2-d][1,3,2]dioxasilin-8-yl]cyclohexan-1-ol |
| SMILES | CC(C)(C)[Si]1(C(C)(C)C)OC[C@H]2OC=C[C@@H](C3(O)CCCCC3)[C@@H]2O1 |
| InChI | InChI=1S/C20H36O4Si/c1-18(2,3)25(19(4,5)6)23-14-16-17(24-25)15(10-13-22-16)20(21)11-8-7-9-12-20/h10,13,15-17,21H,7-9,11-12,14H2,1-6H3/t15-,16-,17+/m1/s1 |
| InChIKey | FVGUFMMZDNONFH-ZACQAIPSSA-N |
| XLogP | 4.67 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.59 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|