C19H28O2 — CID 134951198
(1R,3S,8R,10S,11R,12R)-10-hydroxy-8,11-dimethyl-12-propan-2-yltetracyclo[6.6.0.01,11.03,7]tetradec-6-en-9-one (PubChem CID 134951198) has the molecular formula C19H28O2 and a molecular weight of 288.43 g/mol. Its IUPAC name is (1R,3S,8R,10S,11R,12R)-10-hydroxy-8,11-dimethyl-12-propan-2-yltetracyclo[6.6.0.01,11.03,7]tetradec-6-en-9-one.
| Compound Name | (1R,3S,8R,10S,11R,12R)-10-hydroxy-8,11-dimethyl-12-propan-2-yltetracyclo[6.6.0.01,11.03,7]tetradec-6-en-9-one |
|---|---|
| PubChem CID | 134951198 |
| Molecular Formula | C19H28O2 |
| Molecular Weight | 288.43 g/mol |
| Exact Mass | 288.21 |
| IUPAC Name | (1R,3S,8R,10S,11R,12R)-10-hydroxy-8,11-dimethyl-12-propan-2-yltetracyclo[6.6.0.01,11.03,7]tetradec-6-en-9-one |
| SMILES | CC(C)[C@H]1CC[C@]23C[C@@H]4CCC=C4[C@@]2(C)C(=O)[C@@H](O)[C@]13C |
| InChI | InChI=1S/C19H28O2/c1-11(2)13-8-9-19-10-12-6-5-7-14(12)18(19,4)16(21)15(20)17(13,19)3/h7,11-13,15,20H,5-6,8-10H2,1-4H3/t12-,13+,15+,17-,18-,19+/m0/s1 |
| InChIKey | XIMLXFCETKAWBC-QZTWYXCRSA-N |
| XLogP | 3.74 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.43 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|