C20H18F2O — CID 134951279
3-(3,5-difluorophenyl)-3-[(E)-2-phenylethenyl]cyclohexan-1-one (PubChem CID 134951279) has the molecular formula C20H18F2O and a molecular weight of 312.36 g/mol. Its IUPAC name is 3-(3,5-difluorophenyl)-3-[(E)-2-phenylethenyl]cyclohexan-1-one.
| Compound Name | 3-(3,5-difluorophenyl)-3-[(E)-2-phenylethenyl]cyclohexan-1-one |
|---|---|
| PubChem CID | 134951279 |
| Molecular Formula | C20H18F2O |
| Molecular Weight | 312.36 g/mol |
| Exact Mass | 312.13 |
| IUPAC Name | 3-(3,5-difluorophenyl)-3-[(E)-2-phenylethenyl]cyclohexan-1-one |
| SMILES | O=C1CCCC(/C=C/c2ccccc2)(c2cc(F)cc(F)c2)C1 |
| InChI | InChI=1S/C20H18F2O/c21-17-11-16(12-18(22)13-17)20(9-4-7-19(23)14-20)10-8-15-5-2-1-3-6-15/h1-3,5-6,8,10-13H,4,7,9,14H2/b10-8+ |
| InChIKey | VCOVVHGUGYOXSK-CSKARUKUSA-N |
| XLogP | 5.06 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.36 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |