About (E)-6-cyclohexyl-2,2,3-trimethyl-5-triethylsilylhex-5-en-3-ol
(E)-6-cyclohexyl-2,2,3-trimethyl-5-triethylsilylhex-5-en-3-ol (PubChem CID 134951342) has the molecular formula C21H42OSi
and a molecular weight of 338.65 g/mol. Its IUPAC name is (E)-6-cyclohexyl-2,2,3-trimethyl-5-triethylsilylhex-5-en-3-ol.
Molecular Properties
| Compound Name | (E)-6-cyclohexyl-2,2,3-trimethyl-5-triethylsilylhex-5-en-3-ol |
| PubChem CID | 134951342 |
| Molecular Formula | C21H42OSi |
| Molecular Weight | 338.65 g/mol |
| Exact Mass | 338.30 |
| IUPAC Name | (E)-6-cyclohexyl-2,2,3-trimethyl-5-triethylsilylhex-5-en-3-ol |
| SMILES | CC[Si](CC)(CC)/C(=C/C1CCCCC1)CC(C)(O)C(C)(C)C |
| InChI | InChI=1S/C21H42OSi/c1-8-23(9-2,10-3)19(16-18-14-12-11-13-15-18)17-21(7,22)20(4,5)6/h16,18,22H,8-15,17H2,1-7H3/b19-16+ |
| InChIKey | QSNVXNZMAUSBDP-KNTRCKAVSA-N |
| XLogP | 6.73 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 338.65 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze (E)-6-cyclohexyl-2,2,3-trimethyl-5-triethylsilylhex-5-en-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-6-cyclohexyl-2,2,3-trimethyl-5-triethylsilylhex-5-en-3-ol?
The IUPAC name of (E)-6-cyclohexyl-2,2,3-trimethyl-5-triethylsilylhex-5-en-3-ol (CID 134951342) is (E)-6-cyclohexyl-2,2,3-trimethyl-5-triethylsilylhex-5-en-3-ol.
What is the SMILES notation for (E)-6-cyclohexyl-2,2,3-trimethyl-5-triethylsilylhex-5-en-3-ol?
The canonical SMILES for (E)-6-cyclohexyl-2,2,3-trimethyl-5-triethylsilylhex-5-en-3-ol is CC[Si](CC)(CC)/C(=C/C1CCCCC1)CC(C)(O)C(C)(C)C.
What is the InChIKey of (E)-6-cyclohexyl-2,2,3-trimethyl-5-triethylsilylhex-5-en-3-ol?
The InChIKey is QSNVXNZMAUSBDP-KNTRCKAVSA-N. The full InChI is InChI=1S/C21H42OSi/c1-8-23(9-2,10-3)19(16-18-14-12-11-13-15-18)17-21(7,22)20(4,5)6/h16,18,22H,8-15,17H2,1-7H3/b19-16+.
What are the key properties of (E)-6-cyclohexyl-2,2,3-trimethyl-5-triethylsilylhex-5-en-3-ol?
(E)-6-cyclohexyl-2,2,3-trimethyl-5-triethylsilylhex-5-en-3-ol has a molecular weight of 338.65 g/mol, XLogP of 6.73, 7 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-6-cyclohexyl-2,2,3-trimethyl-5-triethylsilylhex-5-en-3-ol is sourced from PubChem (CID 134951342), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).