C26H25F3O4S — CID 134951347
[4-[1,1,1-trifluoro-4-oxo-4-(4-propan-2-ylphenyl)butan-2-yl]phenyl] 4-methylbenzenesulfonate (PubChem CID 134951347) has the molecular formula C26H25F3O4S and a molecular weight of 490.54 g/mol. Its IUPAC name is [4-[1,1,1-trifluoro-4-oxo-4-(4-propan-2-ylphenyl)butan-2-yl]phenyl] 4-methylbenzenesulfonate.
| Compound Name | [4-[1,1,1-trifluoro-4-oxo-4-(4-propan-2-ylphenyl)butan-2-yl]phenyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 134951347 |
| Molecular Formula | C26H25F3O4S |
| Molecular Weight | 490.54 g/mol |
| Exact Mass | 490.14 |
| IUPAC Name | [4-[1,1,1-trifluoro-4-oxo-4-(4-propan-2-ylphenyl)butan-2-yl]phenyl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)Oc2ccc(C(CC(=O)c3ccc(C(C)C)cc3)C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C26H25F3O4S/c1-17(2)19-6-8-21(9-7-19)25(30)16-24(26(27,28)29)20-10-12-22(13-11-20)33-34(31,32)23-14-4-18(3)5-15-23/h4-15,17,24H,16H2,1-3H3 |
| InChIKey | RFECQPRGWWMMPP-UHFFFAOYSA-N |
| XLogP | 6.81 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.54 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|