C20H17F2NO2 — CID 134951393
(4S)-3-[2-(2,5-difluorophenyl)prop-2-enyl]-4-ethenyl-4-phenyl-1,3-oxazolidin-2-one (PubChem CID 134951393) has the molecular formula C20H17F2NO2 and a molecular weight of 341.36 g/mol. Its IUPAC name is (4S)-3-[2-(2,5-difluorophenyl)prop-2-enyl]-4-ethenyl-4-phenyl-1,3-oxazolidin-2-one.
| Compound Name | (4S)-3-[2-(2,5-difluorophenyl)prop-2-enyl]-4-ethenyl-4-phenyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 134951393 |
| Molecular Formula | C20H17F2NO2 |
| Molecular Weight | 341.36 g/mol |
| Exact Mass | 341.12 |
| IUPAC Name | (4S)-3-[2-(2,5-difluorophenyl)prop-2-enyl]-4-ethenyl-4-phenyl-1,3-oxazolidin-2-one |
| SMILES | C=C[C@]1(c2ccccc2)COC(=O)N1CC(=C)c1cc(F)ccc1F |
| InChI | InChI=1S/C20H17F2NO2/c1-3-20(15-7-5-4-6-8-15)13-25-19(24)23(20)12-14(2)17-11-16(21)9-10-18(17)22/h3-11H,1-2,12-13H2/t20-/m1/s1 |
| InChIKey | MUCCSULQVGAXEJ-HXUWFJFHSA-N |
| XLogP | 4.51 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.36 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|