C16H28O4Si — CID 134951405
[(3R,3aR,5R,5'S)-3-methyl-5'-[(E)-2-trimethylsilylethenyl]spiro[2,3a,6,6a-tetrahydrofuro[3,2-b]furan-5,2'-oxolane]-3-yl]methanol (PubChem CID 134951405) has the molecular formula C16H28O4Si and a molecular weight of 312.48 g/mol. Its IUPAC name is [(3R,3aR,5R,5'S)-3-methyl-5'-[(E)-2-trimethylsilylethenyl]spiro[2,3a,6,6a-tetrahydrofuro[3,2-b]furan-5,2'-oxolane]-3-yl]methanol.
| Compound Name | [(3R,3aR,5R,5'S)-3-methyl-5'-[(E)-2-trimethylsilylethenyl]spiro[2,3a,6,6a-tetrahydrofuro[3,2-b]furan-5,2'-oxolane]-3-yl]methanol |
|---|---|
| PubChem CID | 134951405 |
| Molecular Formula | C16H28O4Si |
| Molecular Weight | 312.48 g/mol |
| Exact Mass | 312.18 |
| IUPAC Name | [(3R,3aR,5R,5'S)-3-methyl-5'-[(E)-2-trimethylsilylethenyl]spiro[2,3a,6,6a-tetrahydrofuro[3,2-b]furan-5,2'-oxolane]-3-yl]methanol |
| SMILES | C[C@@]1(CO)COC2C[C@@]3(CC[C@@H](/C=C/[Si](C)(C)C)O3)O[C@@H]21 |
| InChI | InChI=1S/C16H28O4Si/c1-15(10-17)11-18-13-9-16(20-14(13)15)7-5-12(19-16)6-8-21(2,3)4/h6,8,12-14,17H,5,7,9-11H2,1-4H3/b8-6+/t12-,13?,14-,15+,16+/m0/s1 |
| InChIKey | XQJSBVLYQBDRKE-BBOKADNHSA-N |
| XLogP | 2.48 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.48 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|