C28H50O7Si — CID 134951436
(1R,3S,7R,8R,9S,10E,13S,14R,17S)-13-[tert-butyl(dimethyl)silyl]oxy-17-methoxy-8-(methoxymethoxy)-9,13,17-trimethyl-6,18-dioxatricyclo[12.3.1.03,7]octadec-10-en-5-one (PubChem CID 134951436) has the molecular formula C28H50O7Si and a molecular weight of 526.79 g/mol. Its IUPAC name is (1R,3S,7R,8R,9S,10E,13S,14R,17S)-13-[tert-butyl(dimethyl)silyl]oxy-17-methoxy-8-(methoxymethoxy)-9,13,17-trimethyl-6,18-dioxatricyclo[12.3.1.03,7]octadec-10-en-5-one.
| Compound Name | (1R,3S,7R,8R,9S,10E,13S,14R,17S)-13-[tert-butyl(dimethyl)silyl]oxy-17-methoxy-8-(methoxymethoxy)-9,13,17-trimethyl-6,18-dioxatricyclo[12.3.1.03,7]octadec-10-en-5-one |
|---|---|
| PubChem CID | 134951436 |
| Molecular Formula | C28H50O7Si |
| Molecular Weight | 526.79 g/mol |
| Exact Mass | 526.33 |
| IUPAC Name | (1R,3S,7R,8R,9S,10E,13S,14R,17S)-13-[tert-butyl(dimethyl)silyl]oxy-17-methoxy-8-(methoxymethoxy)-9,13,17-trimethyl-6,18-dioxatricyclo[12.3.1.03,7]octadec-10-en-5-one |
| SMILES | COCO[C@H]1[C@@H]2OC(=O)C[C@@H]2C[C@H]2O[C@H](CC[C@]2(C)OC)[C@@](C)(O[Si](C)(C)C(C)(C)C)C/C=C/[C@@H]1C |
| InChI | InChI=1S/C28H50O7Si/c1-19-12-11-14-28(6,35-36(9,10)26(2,3)4)21-13-15-27(5,31-8)22(33-21)16-20-17-23(29)34-25(20)24(19)32-18-30-7/h11-12,19-22,24-25H,13-18H2,1-10H3/b12-11+/t19-,20-,21+,22+,24+,25+,27-,28-/m0/s1 |
| InChIKey | BUTYHMRXEUPFDL-DPVSEBJXSA-N |
| XLogP | 5.63 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.79 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|