C20H24O4 — CID 134951588
2,2-dimethyl-5-(2-phenyloct-3-yn-2-yl)-1,3-dioxane-4,6-dione (PubChem CID 134951588) has the molecular formula C20H24O4 and a molecular weight of 328.41 g/mol. Its IUPAC name is 2,2-dimethyl-5-(2-phenyloct-3-yn-2-yl)-1,3-dioxane-4,6-dione.
| Compound Name | 2,2-dimethyl-5-(2-phenyloct-3-yn-2-yl)-1,3-dioxane-4,6-dione |
|---|---|
| PubChem CID | 134951588 |
| Molecular Formula | C20H24O4 |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.17 |
| IUPAC Name | 2,2-dimethyl-5-(2-phenyloct-3-yn-2-yl)-1,3-dioxane-4,6-dione |
| SMILES | CCCCC#CC(C)(c1ccccc1)C1C(=O)OC(C)(C)OC1=O |
| InChI | InChI=1S/C20H24O4/c1-5-6-7-11-14-20(4,15-12-9-8-10-13-15)16-17(21)23-19(2,3)24-18(16)22/h8-10,12-13,16H,5-7H2,1-4H3 |
| InChIKey | HPDVYOAYSLVTJU-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|