C17H19Cl3O2 — CID 134951603
(3R,4R)-4-pentyl-3-phenyl-6-(trichloromethyl)-3,4-dihydropyran-2-one (PubChem CID 134951603) has the molecular formula C17H19Cl3O2 and a molecular weight of 361.70 g/mol. Its IUPAC name is (3R,4R)-4-pentyl-3-phenyl-6-(trichloromethyl)-3,4-dihydropyran-2-one.
| Compound Name | (3R,4R)-4-pentyl-3-phenyl-6-(trichloromethyl)-3,4-dihydropyran-2-one |
|---|---|
| PubChem CID | 134951603 |
| Molecular Formula | C17H19Cl3O2 |
| Molecular Weight | 361.70 g/mol |
| Exact Mass | 360.05 |
| IUPAC Name | (3R,4R)-4-pentyl-3-phenyl-6-(trichloromethyl)-3,4-dihydropyran-2-one |
| SMILES | CCCCC[C@@H]1C=C(C(Cl)(Cl)Cl)OC(=O)[C@H]1c1ccccc1 |
| InChI | InChI=1S/C17H19Cl3O2/c1-2-3-5-10-13-11-14(17(18,19)20)22-16(21)15(13)12-8-6-4-7-9-12/h4,6-9,11,13,15H,2-3,5,10H2,1H3/t13-,15+/m1/s1 |
| InChIKey | UGKUXJCQOLUMTK-HIFRSBDPSA-N |
| XLogP | 5.78 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.70 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|