C19H19F3O2 — CID 134951743
2-(4-tert-butylphenyl)-2-[3-(trifluoromethyl)phenyl]acetic acid (PubChem CID 134951743) has the molecular formula C19H19F3O2 and a molecular weight of 336.35 g/mol. Its IUPAC name is 2-(4-tert-butylphenyl)-2-[3-(trifluoromethyl)phenyl]acetic acid.
| Compound Name | 2-(4-tert-butylphenyl)-2-[3-(trifluoromethyl)phenyl]acetic acid |
|---|---|
| PubChem CID | 134951743 |
| Molecular Formula | C19H19F3O2 |
| Molecular Weight | 336.35 g/mol |
| Exact Mass | 336.13 |
| IUPAC Name | 2-(4-tert-butylphenyl)-2-[3-(trifluoromethyl)phenyl]acetic acid |
| SMILES | CC(C)(C)c1ccc(C(C(=O)O)c2cccc(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C19H19F3O2/c1-18(2,3)14-9-7-12(8-10-14)16(17(23)24)13-5-4-6-15(11-13)19(20,21)22/h4-11,16H,1-3H3,(H,23,24) |
| InChIKey | LXSJLLPLYUHVBX-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.35 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |